diethyl 2-acetamido-2-[(3,4-dimethoxy-2-methyl-phenyl)methyl]propanedioate structure
|
Common Name | diethyl 2-acetamido-2-[(3,4-dimethoxy-2-methyl-phenyl)methyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 5456-12-2 | Molecular Weight | 381.42000 | |
| Density | 1.15g/cm3 | Boiling Point | 517.3ºC at 760 mmHg | |
| Molecular Formula | C19H27NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.6ºC | |
| Name | diethyl 2-acetamido-2-[(3,4-dimethoxy-2-methylphenyl)methyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 517.3ºC at 760 mmHg |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.42000 |
| Flash Point | 266.6ºC |
| Exact Mass | 381.17900 |
| PSA | 100.16000 |
| LogP | 1.94670 |
| Index of Refraction | 1.504 |
| InChIKey | UQKWLHYBNNFLMJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(OC)c(OC)c1C)(NC(C)=O)C(=O)OCC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| diethyl(acetylamino)(3,4-dimethoxy-2-methylbenzyl)propanedioate |
| acetylamino-(3,4-dimethoxy-2-methyl-benzyl)-malonic acid diethyl ester |
| Acetylamino-(3,4-dimethoxy-2-methyl-benzyl)-malonsaeure-diaethylester |