Diethyl 2-acetamido-2-[(2-bromo-3,4-dimethoxy-phenyl)methyl]propanedioate structure
|
Common Name | Diethyl 2-acetamido-2-[(2-bromo-3,4-dimethoxy-phenyl)methyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 5456-13-3 | Molecular Weight | 446.29000 | |
| Density | 1.346g/cm3 | Boiling Point | 535ºC at 760mmHg | |
| Molecular Formula | C18H24BrNO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-acetamido-2-[(2-bromo-3,4-dimethoxyphenyl)methyl]propanedioate |
|---|
| Density | 1.346g/cm3 |
|---|---|
| Boiling Point | 535ºC at 760mmHg |
| Molecular Formula | C18H24BrNO7 |
| Molecular Weight | 446.29000 |
| Exact Mass | 445.07400 |
| PSA | 100.16000 |
| LogP | 2.40080 |
| Index of Refraction | 1.521 |
| InChIKey | ALUUJOBUGSMFQC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(OC)c(OC)c1Br)(NC(C)=O)C(=O)OCC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |