2-naphthalen-2-yldiazenylpropanedinitrile structure
|
Common Name | 2-naphthalen-2-yldiazenylpropanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 5456-91-7 | Molecular Weight | 220.22900 | |
| Density | 1.17g/cm3 | Boiling Point | 368ºC at 760 mmHg | |
| Molecular Formula | C13H8N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.3ºC | |
| Name | 2-(naphthalen-2-yldiazenyl)propanedinitrile |
|---|
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 368ºC at 760 mmHg |
| Molecular Formula | C13H8N4 |
| Molecular Weight | 220.22900 |
| Flash Point | 176.3ºC |
| Exact Mass | 220.07500 |
| PSA | 72.30000 |
| LogP | 3.33926 |
| Index of Refraction | 1.635 |
| InChIKey | SOQGPZIOLCAUJJ-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)N=Nc1ccc2ccccc2c1 |
|
~81%
2-naphthalen-2-... CAS#:5456-91-7 |
| Literature: Deeb; Yassin; Ouf; Shehta Chemistry of Heterocyclic Compounds, 2010 , vol. 46, # 2 p. 212 - 222 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |