Propanedioic acid,diphenyl- (9CI) structure
|
Common Name | Propanedioic acid,diphenyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5457-11-4 | Molecular Weight | 256.25300 | |
| Density | 1.334g/cm3 | Boiling Point | 422.5ºC at 760 mmHg | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.4ºC | |
| Name | 2,2-diphenylpropanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 422.5ºC at 760 mmHg |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25300 |
| Flash Point | 223.4ºC |
| Exact Mass | 256.07400 |
| PSA | 74.60000 |
| LogP | 2.14190 |
| Index of Refraction | 1.621 |
| InChIKey | YJGUVTBNQCVSQB-UHFFFAOYSA-N |
| SMILES | O=C(O)C(C(=O)O)(c1ccccc1)c1ccccc1 |
| HS Code | 2917399090 |
|---|
|
~%
Propanedioic ac... CAS#:5457-11-4 |
| Literature: Blicke; Tsao Journal of the American Chemical Society, 1953 , vol. 75, p. 5587,5589 |
|
~%
Propanedioic ac... CAS#:5457-11-4 |
| Literature: Morsman Helvetica Chimica Acta, 1935 , vol. 18, p. 1466 |
|
~%
Propanedioic ac... CAS#:5457-11-4 |
| Literature: Luettringhaus et al. Justus Liebigs Annalen der Chemie, 1947 , vol. 557, p. 46,63 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| diphenylpropanedioic acid |
| Diphenylmalonsaeure |
| diphenyl-malonic acid |