Benzeneacetic acid, a-(1-hydroxycyclohexyl)-, methylester structure
|
Common Name | Benzeneacetic acid, a-(1-hydroxycyclohexyl)-, methylester | ||
|---|---|---|---|---|
| CAS Number | 5457-12-5 | Molecular Weight | 248.31700 | |
| Density | 1.142g/cm3 | Boiling Point | 356.8ºC at 760mmHg | |
| Molecular Formula | C15H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144ºC | |
| Name | methyl 2-(1-hydroxycyclohexyl)-2-phenyl-acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 356.8ºC at 760mmHg |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.31700 |
| Flash Point | 144ºC |
| Exact Mass | 248.14100 |
| PSA | 46.53000 |
| LogP | 2.63840 |
| Index of Refraction | 1.551 |
| InChIKey | NBTORCJZHHCBEP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(c1ccccc1)C1(O)CCCCC1 |
| HS Code | 2918199090 |
|---|
|
~71%
Benzeneacetic a... CAS#:5457-12-5 |
| Literature: Rollin, Y.; Gebehenne, C.; Derien, S.; Dunach, E.; Perichon, J. Journal of Organometallic Chemistry, 1993 , vol. 461, # 1-2 p. 9 - 14 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (1-Hydroxy-cyclohexyl)-phenyl-essigsaeure-methylester |
| (1-hydroxy-cyclohexyl)-phenyl-acetic acid methyl ester |