Benzeneacetic acid, a-(1-hydroxy-3-methylcyclohexyl)- structure
|
Common Name | Benzeneacetic acid, a-(1-hydroxy-3-methylcyclohexyl)- | ||
|---|---|---|---|---|
| CAS Number | 5457-13-6 | Molecular Weight | 248.31700 | |
| Density | 1.171g/cm3 | Boiling Point | 401.9ºC at 760mmHg | |
| Molecular Formula | C15H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211ºC | |
| Name | 2-(1-hydroxy-3-methylcyclohexyl)-2-phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.171g/cm3 |
|---|---|
| Boiling Point | 401.9ºC at 760mmHg |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.31700 |
| Flash Point | 211ºC |
| Exact Mass | 248.14100 |
| PSA | 57.53000 |
| LogP | 2.79600 |
| Index of Refraction | 1.566 |
| InChIKey | ZXADRCVGENLGTA-UHFFFAOYSA-N |
| SMILES | CC1CCCC(O)(C(C(=O)O)c2ccccc2)C1 |
| HS Code | 2918199090 |
|---|
|
~%
Benzeneacetic a... CAS#:5457-13-6 |
| Literature: Blicke, Cox Journal of the American Chemical Society, 1955 , vol. 77, p. 5401 |
|
~%
Benzeneacetic a... CAS#:5457-13-6 |
| Literature: Blicke, Arbor Patent: US2922795 , 1960 ; Chem.Abstr., 1960 , vol. 54, # 19453 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-(1-HYDROXY-3-METHYL-CYCLOHEXYL)-2-PHENYL-ACETIC ACID |
| (1-Hydroxy-3-methyl-cyclohexyl)-phenyl-essigsaeure |
| (1-hydroxy-3-methylcyclohexyl)(phenyl)acetic acid |
| HMS3078O17 |