Propanoic acid,3,3'-thiobis-, 1,1'-bis[2-(phenylmethylene)hydrazide] structure
|
Common Name | Propanoic acid,3,3'-thiobis-, 1,1'-bis[2-(phenylmethylene)hydrazide] | ||
|---|---|---|---|---|
| CAS Number | 5457-16-9 | Molecular Weight | 382.47900 | |
| Density | 1.42g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H22N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.47900 |
| Exact Mass | 382.14600 |
| PSA | 108.22000 |
| LogP | 3.58220 |
| Index of Refraction | 1.571 |
| InChIKey | QSLBHLFMWZFRNA-UHFFFAOYSA-N |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)Nc1ccc(F)c(F)c1F)C2=O |
| HS Code | 2930909090 |
|---|
|
~%
Propanoic acid,... CAS#:5457-16-9 |
| Literature: Zimmer; Shaheen Journal of Organic Chemistry, 1959 , vol. 24, p. 1140 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Propanoic acid,3,3'-thiobis-,1,1'-bis[2-(phenylmethylene)hydrazide] |
| Propionic acid,3,3'-thiodi-,bis(benzylidenehydrazide) (6CI,8CI) |
| Propanoicacid,3,3'-thiobis-,bis[(phenylmethylene)hydrazide] (9CI) |
| 3,3'-sulfanediyl-di-propionic acid bis-benzylidenehydrazide |
| 2-(8-methyl-1,3-dioxo-2,4-diazaspiro[4.5]decan-2-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| 3,3'-Sulfandiyl-di-propionsaeure-bis-benzylidenhydrazid |