2-Pentanone,3-[1,1'-biphenyl]-4-yl-3-methoxy- structure
|
Common Name | 2-Pentanone,3-[1,1'-biphenyl]-4-yl-3-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 5457-34-1 | Molecular Weight | 268.35000 | |
| Density | 1.04g/cm3 | Boiling Point | 393.7ºC at 760mmHg | |
| Molecular Formula | C18H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.1ºC | |
| Name | 3-methoxy-3-(4-phenylphenyl)pentan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 393.7ºC at 760mmHg |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.35000 |
| Flash Point | 164.1ºC |
| Exact Mass | 268.14600 |
| PSA | 26.30000 |
| LogP | 4.19430 |
| Index of Refraction | 1.534 |
| InChIKey | QVFQRKAFEHLCRU-UHFFFAOYSA-N |
| SMILES | CCC(OC)(C(C)=O)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2914509090 |
|---|
|
~%
2-Pentanone,3-[... CAS#:5457-34-1 |
| Literature: Stevens; Dykstra Journal of the American Chemical Society, 1954 , vol. 76, p. 4402,4404 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-biphenyl-4-yl-3-methoxy-pentan-2-one |