N-benzoyl-N-(2,4,6-trinitrophenyl)benzamide structure
|
Common Name | N-benzoyl-N-(2,4,6-trinitrophenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 5457-35-2 | Molecular Weight | 436.33100 | |
| Density | 1.548g/cm3 | Boiling Point | 621.9ºC at 760 mmHg | |
| Molecular Formula | C20H12N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.9ºC | |
| Name | N-benzoyl-N-(2,4,6-trinitrophenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.548g/cm3 |
|---|---|
| Boiling Point | 621.9ºC at 760 mmHg |
| Molecular Formula | C20H12N4O8 |
| Molecular Weight | 436.33100 |
| Flash Point | 329.9ºC |
| Exact Mass | 436.06600 |
| PSA | 174.84000 |
| LogP | 5.46800 |
| Index of Refraction | 1.71 |
| InChIKey | LOLYHAROGGKYOP-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)N(C(=O)c1ccccc1)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
N-benzoyl-N-(2,... CAS#:5457-35-2 |
| Literature: Thompson Journal of the American Chemical Society, 1951 , vol. 73, p. 5841,5844 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-picryl-dibenzamide |