Acetic acid, 2-chloro-,1,3-benzodioxol-5-ylmethyl ester structure
|
Common Name | Acetic acid, 2-chloro-,1,3-benzodioxol-5-ylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5457-71-6 | Molecular Weight | 228.62900 | |
| Density | 1.387g/cm3 | Boiling Point | 323.8ºC at 760mmHg | |
| Molecular Formula | C10H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.9ºC | |
| Name | 1,3-benzodioxol-5-ylmethyl 2-chloroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 323.8ºC at 760mmHg |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.62900 |
| Flash Point | 139.9ºC |
| Exact Mass | 228.01900 |
| PSA | 44.76000 |
| LogP | 1.69730 |
| Index of Refraction | 1.559 |
| InChIKey | OOLGQDFBONNDEU-UHFFFAOYSA-N |
| SMILES | O=C(CCl)OCc1ccc2c(c1)OCO2 |
| HS Code | 2932999099 |
|---|
|
~%
Acetic acid, 2-... CAS#:5457-71-6 |
| Literature: Gertler et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 327 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| chloro-acetic acid piperonyl ester |
| 1,3-benzodioxol-5-ylmethyl chloroacetate |
| Chlor-essigsaeure-piperonylester |