8-Oxoheptadecanoic acid methyl ester
Modify Date: 2025-11-02 02:10:07
8-Oxoheptadecanoic acid methyl ester structure
|
Common Name | 8-Oxoheptadecanoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 54575-44-9 | Molecular Weight | 298.46100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 8-oxoheptadecanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H34O3 |
|---|---|
| Molecular Weight | 298.46100 |
| Exact Mass | 298.25100 |
| PSA | 43.37000 |
| LogP | 5.20980 |
| InChIKey | FMBGLCLEWQEIHI-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)CCCCCCC(=O)OC |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methyl-8-oxoheptadecanoat |
| 8-Oxoheptadecanoic acid methyl ester |