2,4,4-Trimethyl-6-oxocyclohexanecarboxylic acid methyl ester structure
|
Common Name | 2,4,4-Trimethyl-6-oxocyclohexanecarboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 54576-10-2 | Molecular Weight | 198.25900 | |
| Density | 0.996g/cm3 | Boiling Point | 256.5ºC at 760 mmHg | |
| Molecular Formula | C11H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 105.5ºC | |
| Name | methyl 2,4,4-trimethyl-6-oxocyclohexane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.996g/cm3 |
|---|---|
| Boiling Point | 256.5ºC at 760 mmHg |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.25900 |
| Flash Point | 105.5ºC |
| Exact Mass | 198.12600 |
| PSA | 43.37000 |
| LogP | 1.80080 |
| Index of Refraction | 1.443 |
| InChIKey | ZYRYVGBRDTVCMK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C(=O)CC(C)(C)CC1C |
| HS Code | 2918300090 |
|---|
|
~%
2,4,4-Trimethyl... CAS#:54576-10-2 |
| Literature: Salomon,R.G.; Salomon,M.F. Journal of Organic Chemistry, 1975 , vol. 40, # 10 p. 1488 - 1492 |
|
~%
2,4,4-Trimethyl... CAS#:54576-10-2 |
| Literature: Salomon,R.G.; Salomon,M.F. Journal of Organic Chemistry, 1975 , vol. 40, # 10 p. 1488 - 1492 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 6-Acetoxy-3,3,5-trimethyl-cyclohexanon |
| methyl 2,4,4-trimethyl-6-oxocyclohexanecarboxylate |
| 2-Carbomethoxy-3.5.5-trimethoxycyclohexanon |
| Cyclohexanecarboxylic acid,2,4,4-trimethyl-6-oxo-,methyl ester |
| Carbomethoxydihydroisophorone |
| 2,4,4-Trimethyl-6-oxocyclohexanecarboxylic acid methyl ester |