prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate
Modify Date: 2025-09-30 15:15:08
prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate structure
|
Common Name | prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5458-63-9 | Molecular Weight | 208.29700 | |
| Density | 0.993g/cm3 | Boiling Point | 252.2ºC at 760 mmHg | |
| Molecular Formula | C13H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.9ºC | |
| Name | prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.993g/cm3 |
|---|---|
| Boiling Point | 252.2ºC at 760 mmHg |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.29700 |
| Flash Point | 97.9ºC |
| Exact Mass | 208.14600 |
| PSA | 26.30000 |
| LogP | 2.95400 |
| Index of Refraction | 1.516 |
| InChIKey | HWLGQBWMTVDBMJ-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C1C(C=C(C)C)C1(C)C |
| HS Code | 2916209090 |
|---|
|
~%
prop-2-enyl 2,2... CAS#:5458-63-9 |
| Literature: Alexander,B.H. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 626 - 632 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| prop-2-en-1-yl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate |
| Chrysanthemumsaeure-allylester |