prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate structure
|
Common Name | prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5458-63-9 | Molecular Weight | 208.29700 | |
| Density | 0.993g/cm3 | Boiling Point | 252.2ºC at 760 mmHg | |
| Molecular Formula | C13H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.993g/cm3 |
|---|---|
| Boiling Point | 252.2ºC at 760 mmHg |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.29700 |
| Flash Point | 97.9ºC |
| Exact Mass | 208.14600 |
| PSA | 26.30000 |
| LogP | 2.95400 |
| Index of Refraction | 1.516 |
| InChIKey | HWLGQBWMTVDBMJ-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C1C(C=C(C)C)C1(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2916209090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
prop-2-enyl 2,2... CAS#:5458-63-9 |
| Literature: Alexander,B.H. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 626 - 632 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| prop-2-en-1-yl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate |
| Chrysanthemumsaeure-allylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate? |
| A: Polar surface area (PSA) of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate is 26.30000. |
| Q: What is the molecular weight of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate? |
| A: Molecular weight of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate is 208.29700. |
| Q: What is the CAS number of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate? |
| A: CAS number of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate is 5458-63-9. |
| Q: What is the molecular formula of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate? |
| A: Molecular formula of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate is C13H20O2. |
| Q: What is the English name of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate? |
| A: The English name of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate is prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate. |
| Q: What are the upstream materials of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate? |
| A: Related upstream materials(CAS) of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate: 4489-12-7;107-18-6. |
| Q: What is the SMILES notation of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate? |
| A: SMILES notation of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate is C=CCOC(=O)C1C(C=C(C)C)C1(C)C. |
| Q: What is the boiling point of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate? |
| A: Boiling point of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate is 252.2ºC at 760 mmHg. |
| Q: What is the Chinese name of 5458-63-9? |
| A: Chinese name of 5458-63-9 is 5458-63-9. |
| Q: What is the LogP of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate? |
| A: LogP of prop-2-enyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate is 2.95400. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |