butan-2-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate
Modify Date: 2025-11-27 18:00:10
butan-2-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate structure
|
Common Name | butan-2-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5458-67-3 | Molecular Weight | 224.33900 | |
| Density | 0.969g/cm3 | Boiling Point | 259.5ºC at 760mmHg | |
| Molecular Formula | C14H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102.4ºC | |
| Name | butan-2-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.969g/cm3 |
|---|---|
| Boiling Point | 259.5ºC at 760mmHg |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.33900 |
| Flash Point | 102.4ºC |
| Exact Mass | 224.17800 |
| PSA | 26.30000 |
| LogP | 3.56650 |
| Index of Refraction | 1.501 |
| InChIKey | DIGVJZSKWPJFCG-UHFFFAOYSA-N |
| SMILES | CCC(C)OC(=O)C1C(C=C(C)C)C1(C)C |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (+)-trans-Chrysanthemumsaeure-sec-butylester |
| 1R-trans-Chrysanthemsaeure-sec.-butylester |
| (+)-trans-chrysanthemumic acid sec-butyl ester |
| butan-2-yl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate |