2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene
2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene structure
|
Common Name | 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene | ||
|---|---|---|---|---|
| CAS Number | 54580-22-2 | Molecular Weight | 192.34000 | |
| Density | 0.796g/cm3 | Boiling Point | 263.4ºC at 760 mmHg | |
| Molecular Formula | C14H24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.796g/cm3 |
|---|---|
| Boiling Point | 263.4ºC at 760 mmHg |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.34000 |
| Flash Point | 103.2ºC |
| Exact Mass | 192.18800 |
| LogP | 4.89130 |
| Index of Refraction | 1.458 |
| InChIKey | OJTPBFFQIYTXSJ-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=C(C)C)C(=C(C)C)C(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 3 | |
CAS#:114522-88-2
CAS#:1133-23-9
CAS#:58721-02-1
CAS#:107464-94-8
CAS#:107464-93-7
CAS#:114522-87-1
CAS#:69856-67-3
CAS#:527-84-4
CAS#:106-42-3
CAS#:54580-23-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-Hexadiene,2,5-dimethyl-4-(1-methylethyl)-3-(1-methylethylidene) |
| 2,5-dimethyl-4-(propan-2-yl)-3-(propan-2-ylidene)hexa-1,4-diene |
| 2,5-Dimethyl-3-isopropyl-4-isopropyliden-hexadien-2,5 |
| 2,5-dimethyl-4-isopropyl-3-isopropylidenehexa-1,4-diene |
| 4-isopropyl-3-isopropylidene-2,5-dimethylhexa-1,4-diene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene? |
| A: CAS number of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene is 54580-22-2. |
| Q: What are the downstream products of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene? |
| A: Related downstream products(CAS) of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene: 527-84-4;106-42-3;54580-23-3. |
| Q: What are the upstream materials of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene? |
| A: Related upstream materials(CAS) of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene: 114522-88-2;1133-23-9;58721-02-1;107464-94-8;107464-93-7;114522-87-1;69856-67-3. |
| Q: What is the SMILES notation of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene? |
| A: SMILES notation of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene is C=C(C)C(=C(C)C)C(=C(C)C)C(C)C. |
| Q: What is the boiling point of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene? |
| A: Boiling point of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene is 263.4ºC at 760 mmHg. |
| Q: What is the LogP of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene? |
| A: LogP of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene is 4.89130. |
| Q: What is the English name of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene? |
| A: The English name of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene is 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene. |
| Q: What is the molecular formula of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene? |
| A: Molecular formula of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene is C14H24. |
| Q: What is the molecular weight of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene? |
| A: Molecular weight of 2,5-dimethyl-4-propan-2-yl-3-propan-2-ylidenehexa-1,4-diene is 192.34000. |
| Q: What is the Chinese name of 54580-22-2? |
| A: Chinese name of 54580-22-2 is 54580-22-2. |