3-ethyl-2-methylnaphtho[2,1-d]thiazolium iodide structure
|
Common Name | 3-ethyl-2-methylnaphtho[2,1-d]thiazolium iodide | ||
|---|---|---|---|---|
| CAS Number | 54581-48-5 | Molecular Weight | 355.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14INS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14INS |
|---|---|
| Molecular Weight | 355.23700 |
| Exact Mass | 354.98900 |
| PSA | 32.12000 |
| LogP | 0.67430 |
| InChIKey | FYBFVOIEBIMSNZ-UHFFFAOYSA-M |
| SMILES | CC[n+]1c(C)sc2c3ccccc3ccc21.[I-] |
| HS Code | 2934999090 |
|---|
|
~%
3-ethyl-2-methy... CAS#:54581-48-5 |
| Literature: Hamer Journal of the Chemical Society, 1929 , p. 2604 |
|
~%
3-ethyl-2-methy... CAS#:54581-48-5 |
| Literature: Narayanan, Narasimhachari; Patonay, Gabor Journal of Organic Chemistry, 1995 , vol. 60, # 8 p. 2391 - 2395 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-ethyl-2-methylbenzo[g][1,3]benzothiazol-3-ium iodide |
| 3-Aethyl-2-methyl-naphtho[2,1-d]thiazolium,Jodid |
| 3-Ethyl-2-methylnaphtho(2,1-d)thiazolium iodide |
| Naphtho[2,1-d]thiazolium,3-ethyl-2-methyl-,iodide (9CI) |
| Naphtho[2,1-d]thiazolium,3-ethyl-2-methyl-,iodide (1:1) |
| EINECS 259-243-8 |