Arsonic acid,[1,1'-biphenyl]-4-yl- (9CI) structure
|
Common Name | Arsonic acid,[1,1'-biphenyl]-4-yl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5459-30-3 | Molecular Weight | 278.13600 | |
| Density | N/A | Boiling Point | 515.9ºC at 760 mmHg | |
| Molecular Formula | C12H11AsO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.9ºC | |
| Name | (4-phenylphenyl)arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 515.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H11AsO3 |
| Molecular Weight | 278.13600 |
| Flash Point | 279.9ºC |
| Exact Mass | 277.99200 |
| PSA | 57.53000 |
| LogP | 0.91460 |
| InChIKey | GDSQIFLFJMCOMG-UHFFFAOYSA-N |
| SMILES | O=[As](O)(O)c1ccc(-c2ccccc2)cc1 |
|
~%
Arsonic acid,[1... CAS#:5459-30-3 |
|
Literature: Lettermann Diss. |
|
~%
Arsonic acid,[1... CAS#:5459-30-3 |
| Literature: Oneto; Way Journal of the American Chemical Society, 1941 , vol. 63, p. 3068 |
|
~%
Arsonic acid,[1... CAS#:5459-30-3 |
| Literature: Bart Justus Liebigs Annalen der Chemie, 1922 , vol. 429, p. 100 Full Text Show Details Schmidt Justus Liebigs Annalen der Chemie, 1920 , vol. 421, p. 170 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Biphenylarsonic acid |
| p-Diphenylarsonsaeure |
| Biphenyl-4-yl-arsonsaeure |
| biphenyl-4-ylarsonic acid |
| p-Diphenylylarsonsaeure |