3-(10-methoxybenzo[c]phenothiazin-7-yl)-N,N-dimethylpropan-1-amine structure
|
Common Name | 3-(10-methoxybenzo[c]phenothiazin-7-yl)-N,N-dimethylpropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 5459-32-5 | Molecular Weight | 364.50400 | |
| Density | 1.179g/cm3 | Boiling Point | 540.9ºC at 760 mmHg | |
| Molecular Formula | C22H24N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.9ºC | |
| Name | 3-(10-methoxybenzo[c]phenothiazin-7-yl)-N,N-dimethylpropan-1-amine |
|---|
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 540.9ºC at 760 mmHg |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.50400 |
| Flash Point | 280.9ºC |
| Exact Mass | 364.16100 |
| PSA | 41.01000 |
| LogP | 5.46780 |
| Index of Refraction | 1.647 |
| InChIKey | HWWVHHSHFWKHQH-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)Sc1c(ccc3ccccc13)N2CCCN(C)C |
| HS Code | 2934999090 |
|---|
|
~%
3-(10-methoxybe... CAS#:5459-32-5 |
| Literature: Shirley; Tatum Journal of the American Chemical Society, 1959 , vol. 81, p. 496 |
|
~%
3-(10-methoxybe... CAS#:5459-32-5 |
| Literature: Shirley; Tatum Journal of the American Chemical Society, 1959 , vol. 81, p. 496 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |