N-(7-acetamido-3,6-dinitro-9H-fluoren-2-yl)acetamide structure
|
Common Name | N-(7-acetamido-3,6-dinitro-9H-fluoren-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 5459-48-3 | Molecular Weight | 370.31600 | |
| Density | 1.554g/cm3 | Boiling Point | 730.7ºC at 760 mmHg | |
| Molecular Formula | C17H14N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 395.7ºC | |
| Name | N-(7-acetamido-3,6-dinitro-9H-fluoren-2-yl)acetamide |
|---|
| Density | 1.554g/cm3 |
|---|---|
| Boiling Point | 730.7ºC at 760 mmHg |
| Molecular Formula | C17H14N4O6 |
| Molecular Weight | 370.31600 |
| Flash Point | 395.7ºC |
| Exact Mass | 370.09100 |
| PSA | 149.84000 |
| LogP | 4.18340 |
| Index of Refraction | 1.733 |
| InChIKey | NJRKPHDEBKIZAT-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc2c(cc1[N+](=O)[O-])-c1cc([N+](=O)[O-])c(NC(C)=O)cc1C2 |
|
~%
N-(7-acetamido-... CAS#:5459-48-3 |
| Literature: Barker; Barker Journal of the Chemical Society, 1954 , p. 870,872 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |