Divabuterol structure
|
Common Name | Divabuterol | ||
|---|---|---|---|---|
| CAS Number | 54592-27-7 | Molecular Weight | 393.51700 | |
| Density | 1.064g/cm3 | Boiling Point | 494ºC at 760 mmHg | |
| Molecular Formula | C22H35NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.6ºC | |
| Name | [3-[2-(tert-butylamino)-1-hydroxyethyl]-5-(2,2-dimethylpropanoyloxy)phenyl] 2,2-dimethylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.064g/cm3 |
|---|---|
| Boiling Point | 494ºC at 760 mmHg |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.51700 |
| Flash Point | 252.6ºC |
| Exact Mass | 393.25200 |
| PSA | 84.86000 |
| LogP | 4.40200 |
| Index of Refraction | 1.505 |
| InChIKey | VJJOKWOJJZKXNV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(O)c1cc(OC(=O)C(C)(C)C)cc(OC(=O)C(C)(C)C)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| divabuterol |
| UNII-BVG9H4U2ZB |