methyl propyl 1,2,2,2-tetrachloroethyl phosphate
methyl propyl 1,2,2,2-tetrachloroethyl phosphate structure
|
Common Name | methyl propyl 1,2,2,2-tetrachloroethyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 54593-68-9 | Molecular Weight | 319.93500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11Cl4O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl propyl 1,2,2,2-tetrachloroethyl phosphate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H11Cl4O4P |
|---|---|
| Molecular Weight | 319.93500 |
| Exact Mass | 317.91500 |
| PSA | 54.57000 |
| LogP | 4.11920 |
| InChIKey | JZAMAPFNILUWEU-UHFFFAOYSA-N |
| SMILES | CCCOP(=O)(OC)OC(Cl)C(Cl)(Cl)Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
methyl propyl 1... CAS#:54593-68-9 |
| Literature: Matschiner,H. et al. Journal fuer Praktische Chemie (Leipzig), 1977 , vol. 319, p. 561 - 567 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phosphoric acid,methyl propyl 1,2,2,2-tetrachloroethyl ester |
| phosphoric acid methyl ester propyl ester 1,2,2,2-tetrachloro-ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of methyl propyl 1,2,2,2-tetrachloroethyl phosphate? |
| A: Molecular formula of methyl propyl 1,2,2,2-tetrachloroethyl phosphate is C6H11Cl4O4P. |
| Q: What English synonyms does methyl propyl 1,2,2,2-tetrachloroethyl phosphate have? |
| A: English synonyms of methyl propyl 1,2,2,2-tetrachloroethyl phosphate: Phosphoric acid,methyl propyl 1,2,2,2-tetrachloroethyl ester, phosphoric acid methyl ester propyl ester 1,2,2,2-tetrachloro-ethyl ester. |
| Q: What is the English name of methyl propyl 1,2,2,2-tetrachloroethyl phosphate? |
| A: The English name of methyl propyl 1,2,2,2-tetrachloroethyl phosphate is methyl propyl 1,2,2,2-tetrachloroethyl phosphate. |
| Q: What is the Chinese name of 54593-68-9? |
| A: Chinese name of 54593-68-9 is 54593-68-9. |
| Q: What is the molecular weight of methyl propyl 1,2,2,2-tetrachloroethyl phosphate? |
| A: Molecular weight of methyl propyl 1,2,2,2-tetrachloroethyl phosphate is 319.93500. |
| Q: What is the polar surface area (PSA) of methyl propyl 1,2,2,2-tetrachloroethyl phosphate? |
| A: Polar surface area (PSA) of methyl propyl 1,2,2,2-tetrachloroethyl phosphate is 54.57000. |
| Q: What are the upstream materials of methyl propyl 1,2,2,2-tetrachloroethyl phosphate? |
| A: Related upstream materials(CAS) of methyl propyl 1,2,2,2-tetrachloroethyl phosphate: 67-56-1;71-23-8;41998-91-8. |
| Q: What is the LogP of methyl propyl 1,2,2,2-tetrachloroethyl phosphate? |
| A: LogP of methyl propyl 1,2,2,2-tetrachloroethyl phosphate is 4.11920. |
| Q: What is the CAS number of methyl propyl 1,2,2,2-tetrachloroethyl phosphate? |
| A: CAS number of methyl propyl 1,2,2,2-tetrachloroethyl phosphate is 54593-68-9. |
| Q: What is the InChIKey of methyl propyl 1,2,2,2-tetrachloroethyl phosphate? |
| A: InChIKey of methyl propyl 1,2,2,2-tetrachloroethyl phosphate is JZAMAPFNILUWEU-UHFFFAOYSA-N. |