Pummerers ketone structure
|
Common Name | Pummerers ketone | ||
|---|---|---|---|---|
| CAS Number | 546-24-7 | Molecular Weight | 214.26000 | |
| Density | 1.174g/cm3 | Boiling Point | 296.9ºC at 760 mmHg | |
| Molecular Formula | C14H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.4ºC | |
| Name | 8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 296.9ºC at 760 mmHg |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26000 |
| Flash Point | 123.4ºC |
| Exact Mass | 214.09900 |
| PSA | 26.30000 |
| LogP | 2.54270 |
| Index of Refraction | 1.584 |
| InChIKey | RGTPQXAKJODXMX-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)C1(C)C=CC(=O)CC1O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pumerrer's ketone |
| 8,9b-dimethyl-4a,9b-dihydro-4H-dibenzofuran-3-one |
| Pummerer ketone |
| Pummerer's ketone |