1-[ethoxy(ethyl)phosphoryl]oxy-4-nitrobenzene structure
|
Common Name | 1-[ethoxy(ethyl)phosphoryl]oxy-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 546-71-4 | Molecular Weight | 259.19600 | |
| Density | 1.262g/cm3 | Boiling Point | 368.9ºC at 760mmHg | |
| Molecular Formula | C10H14NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.9ºC | |
| Name | 1-[ethoxy(ethyl)phosphoryl]oxy-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 368.9ºC at 760mmHg |
| Molecular Formula | C10H14NO5P |
| Molecular Weight | 259.19600 |
| Flash Point | 176.9ºC |
| Exact Mass | 259.06100 |
| PSA | 91.16000 |
| LogP | 3.74630 |
| InChIKey | XXUJMEYKYHETBZ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC)Oc1ccc([N+](=O)[O-])cc1 |
|
~%
1-[ethoxy(ethyl... CAS#:546-71-4 |
| Literature: Fukuto; Metcalf Journal of the American Chemical Society, 1959 , vol. 81, p. 372,374 |
|
~%
1-[ethoxy(ethyl... CAS#:546-71-4 |
| Literature: Savelova; Belousova; Simanenko; Popov Russian Journal of Organic Chemistry, 1999 , vol. 35, # 12 p. 1790 - 1796 |
|
~%
1-[ethoxy(ethyl... CAS#:546-71-4 |
| Literature: Rasumow et al. Zhurnal Obshchei Khimii, 1957 , vol. 27, p. 2394; engl. Ausg. S. 2455 |
| 4-nitrophenyl ethyl ethylphosphonate |
| O-p-nitrophenyl-O-ethyethylphosphonate |
| Arminum |
| Armin |
| p-Nitrophenyl-O-ethyl ethylphosphonate |
| Armin (ester) |
| O-ethyl-O-p-nitrophenylethylphosphonate |
| Armine |
| Ethyl p-nitrophenyl ethylphosphonate |
| O-p-nitrophenyl O-ethyl ethyl phosphonate |
| Ethyl 4-nitrophenyl ethylphosphonate |