Benzenesulfonic acid,4-nitro-, 2-(1-methylpropylidene)hydrazide structure
|
Common Name | Benzenesulfonic acid,4-nitro-, 2-(1-methylpropylidene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 5460-17-3 | Molecular Weight | 271.29300 | |
| Density | 1.36g/cm3 | Boiling Point | 429.7ºC at 760mmHg | |
| Molecular Formula | C10H13N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.7ºC | |
| Name | N-(butan-2-ylideneamino)-4-nitrobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 429.7ºC at 760mmHg |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.29300 |
| Flash Point | 213.7ºC |
| Exact Mass | 271.06300 |
| PSA | 112.73000 |
| LogP | 3.65390 |
| Index of Refraction | 1.593 |
| InChIKey | VQQKZJUGHIWFRA-UHFFFAOYSA-N |
| SMILES | CCC(C)=NNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2935009090 |
|---|
|
~%
Benzenesulfonic... CAS#:5460-17-3 |
| Literature: Yamashita, Mitsuji; Takeuchi, Jun; Nakatani, Kaname; Oshikawa, Tatsuo; Inokawa, Saburo Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 1 p. 377 - 378 |
|
~72%
Benzenesulfonic... CAS#:5460-17-3 |
| Literature: Yamashita, Mitsuji; Takeuchi, Jun; Nakatani, Kaname; Oshikawa, Tatsuo; Inokawa, Saburo Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 1 p. 377 - 378 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Benzenesulfonic acid,4-nitro-,2-(1-methylpropylidene)hydrazide |
| N-(BUTAN-2-YLIDENEAMINO)-4-NITRO-BENZENESULFONAMIDE |
| Benzenesulfonicacid,4-nitro-,(1-methylpropylidene)hydrazide (9CI) |
| 4-Nitro-benzolsulfonsaeure-sec-butylidenhydrazid |
| 4-nitro-benzenesulfonic acid sec-butylidenehydrazide |
| 2-Butanone p-nitrophenylsulfonylhydrazone |