2-amino-3-[(2-amino-2-carboxy-ethyl)sulfanyl-(4-carbamoylphenyl)arsanyl]sulfanyl-propanoic acid structure
|
Common Name | 2-amino-3-[(2-amino-2-carboxy-ethyl)sulfanyl-(4-carbamoylphenyl)arsanyl]sulfanyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5460-38-8 | Molecular Weight | 435.35100 | |
| Density | N/A | Boiling Point | 671.9ºC at 760 mmHg | |
| Molecular Formula | C13H18AsN3O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 360.2ºC | |
| Name | S.S'-(4-carbamoyl-phenylarsanediyl)-bis-L-cysteine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 671.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H18AsN3O5S2 |
| Molecular Weight | 435.35100 |
| Flash Point | 360.2ºC |
| Exact Mass | 434.99000 |
| PSA | 220.33000 |
| LogP | 0.87180 |
| InChIKey | SRHIEGHDCWTIRG-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc([As](SCC(N)C(=O)O)SCC(N)C(=O)O)cc1 |
|
~%
2-amino-3-[(2-a... CAS#:5460-38-8 |
| Literature: Cohen; King; Strangeways Journal of the Chemical Society, 1931 , p. 3043,3053 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| S.S'-(3-Amino-4-hydroxy-phenylarsandiyl)-bis-L-cystein |
| S.S'-(4-Carbamoyl-phenylarsandiyl)-bis-L-cystein |
| Bis-((R)-2-amino-2-carboxy-aethylmercapto)-(4-carbamoyl-phenyl)-arsin |
| 2,2-dimethyl-1,3-bis(diphenylphosphino)-2-silapropane |
| Phosphine,[(dimethylsilylene)bis(methylene)]bis[diphenyl |
| bis((diphenylphosphino)methyl)dimethylsilane |
| Bis-((R)-2-amino-2-carboxy-aethylmercapto)-(3-amino-4-hydroxy-phenyl)-arsin |
| 2,2-dimethyl-2-sila-1,3-bis(diphenylphosphino)propane |