3-chloro-N-(2-methyl-6-propan-2-ylphenyl)propanamide
Modify Date: 2025-08-29 20:13:27
3-chloro-N-(2-methyl-6-propan-2-ylphenyl)propanamide structure
|
Common Name | 3-chloro-N-(2-methyl-6-propan-2-ylphenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 546079-44-1 | Molecular Weight | 239.74100 | |
| Density | 1.106g/cm3 | Boiling Point | 366.2ºC at 760 mmHg | |
| Molecular Formula | C13H18ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | 3-chloro-N-(2-methyl-6-propan-2-ylphenyl)propanamide |
|---|
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 366.2ºC at 760 mmHg |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.74100 |
| Flash Point | 175.3ºC |
| Exact Mass | 239.10800 |
| PSA | 29.10000 |
| LogP | 3.75880 |
| Index of Refraction | 1.549 |
| InChIKey | HJOYSVHQOMIWHS-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)CCCl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |