Propanoic acid,2-methyl-, 1,3-benzodioxol-5-ylmethyl ester structure
|
Common Name | Propanoic acid,2-methyl-, 1,3-benzodioxol-5-ylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5461-08-5 | Molecular Weight | 222.23700 | |
| Density | 1.154 g/mL at 25 °C(lit.) | Boiling Point | 91-92 °C0.005 mm Hg(lit.) | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Name | piperonyl isobutyrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 91-92 °C0.005 mm Hg(lit.) |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | >230 °F |
| Exact Mass | 222.08900 |
| PSA | 44.76000 |
| LogP | 2.11450 |
| Index of Refraction | n20/D 1.511(lit.) |
| InChIKey | RQULTIASPCVEFO-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OCc1ccc2c(c1)OCO2 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
|
~%
Propanoic acid,... CAS#:5461-08-5 |
| Literature: Journal of Organic Chemistry, , vol. 24, p. 327 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
The metabolism of some food additives related to piperonal in the rabbit.
Xenobiotica 10(4) , 265-70, (1980) 1. The metabolism of piperonylidene acetone, and the food additives piperonyl acetone, piperonyl acetate and piperonyl isobutyrate were studied in male rabbits after oral doses of 100 mg/kg. 2. Both p... |
| MFCD00005826 |
| EINECS 226-745-3 |
| 1,3-benzodioxol-5-ylmethyl 2-methylpropanoate |