ethyl 2,3-dihydroxy-3,3-diphenyl-propanoate structure
|
Common Name | ethyl 2,3-dihydroxy-3,3-diphenyl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 5461-98-3 | Molecular Weight | 286.32200 | |
| Density | 1.22g/cm3 | Boiling Point | 464.7ºC at 760 mmHg | |
| Molecular Formula | C17H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.7ºC | |
| Name | ethyl 2,3-dihydroxy-3,3-diphenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 464.7ºC at 760 mmHg |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.32200 |
| Flash Point | 169.7ºC |
| Exact Mass | 286.12100 |
| PSA | 66.76000 |
| LogP | 1.84650 |
| Index of Refraction | 1.583 |
| InChIKey | IMFHJEWTIWGYLI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(O)C(O)(c1ccccc1)c1ccccc1 |
| HS Code | 2918199090 |
|---|
|
~68%
ethyl 2,3-dihyd... CAS#:5461-98-3 |
| Literature: Scheffler, Ulf; Stoesser, Reinhard; Mahrwald, Rainer Advanced Synthesis and Catalysis, 2012 , vol. 354, # 14-15 p. 2648 - 2652,5 |
|
~%
ethyl 2,3-dihyd... CAS#:5461-98-3 |
| Literature: Sugiyama,N. et al. Bulletin of the Chemical Society of Japan, 1967 , vol. 40, p. 2909 - 2913 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ETHYL 2,3-DIHYDROXY-3,3-DIPHENYL-PROPANOATE |
| 2,3-dihydroxy-3,3-diphenyl-propionic acid ethyl ester |
| 3,3-Diphenyl-2,3-dihydroxy-propionsaeure-ethylester |
| ethyl 2,3-dihydroxy-3,3-diphenylpropanonate |
| 2.3-Dihydroxy-3.3-diphenyl-propionsaeure-aethylester |