sodium 4-(4-hydroxyphenyl)phenolate structure
|
Common Name | sodium 4-(4-hydroxyphenyl)phenolate | ||
|---|---|---|---|---|
| CAS Number | 54614-69-6 | Molecular Weight | 208.18800 | |
| Density | N/A | Boiling Point | 355.2ºC at 760 mmHg | |
| Molecular Formula | C12H9NaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.1ºC | |
| Name | sodium,4-(4-hydroxyphenyl)phenolate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 355.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H9NaO2 |
| Molecular Weight | 208.18800 |
| Flash Point | 176.1ºC |
| Exact Mass | 208.05000 |
| PSA | 43.29000 |
| LogP | 3.20300 |
| InChIKey | XPFZNHSLPJKFAS-UHFFFAOYSA-M |
| SMILES | [Na+].[O-]c1ccc(-c2ccc(O)cc2)cc1 |
| potassium salt of 4,4'-dihydroxybiphenyl |
| 92-88-6 (Parent) |
| 4,4'-biphenol disodium salt |
| Sodium 4-(4-hydroxyphenyl)phenolate |
| EINECS 259-254-8 |
| sodium salt of biphenol |