1-(4,5-dichloro-2-methyl-phenyl)-2-(dipentylamino)ethanol structure
|
Common Name | 1-(4,5-dichloro-2-methyl-phenyl)-2-(dipentylamino)ethanol | ||
|---|---|---|---|---|
| CAS Number | 5462-73-7 | Molecular Weight | 360.36200 | |
| Density | 1.082g/cm3 | Boiling Point | 459.5ºC at 760 mmHg | |
| Molecular Formula | C19H31Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.7ºC | |
| Name | 1-(4,5-dichloro-2-methylphenyl)-2-(dipentylamino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.082g/cm3 |
|---|---|
| Boiling Point | 459.5ºC at 760 mmHg |
| Molecular Formula | C19H31Cl2NO |
| Molecular Weight | 360.36200 |
| Flash Point | 231.7ºC |
| Exact Mass | 359.17800 |
| PSA | 23.47000 |
| LogP | 6.01760 |
| Index of Refraction | 1.524 |
| InChIKey | XAOUNCPWJADRER-UHFFFAOYSA-N |
| SMILES | CCCCCN(CCCCC)CC(O)c1cc(Cl)c(Cl)cc1C |
|
~%
1-(4,5-dichloro... CAS#:5462-73-7 |
| Literature: Lutz et al. Journal of Organic Chemistry, 1947 , vol. 12, p. 617,680 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-(4,5-dichloro-2-methyl-phenyl)-2-dipentylamino-ethanol |
| 1-(4,5-Dichlor-2-methyl-phenyl)-2-dipentylamino-aethanol |