ethenol,ethenyl acetate,methyl 2-methylprop-2-enoate structure
|
Common Name | ethenol,ethenyl acetate,methyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 54626-91-4 | Molecular Weight | 230.25800 | |
| Density | N/A | Boiling Point | 100.3ºC at 760 mmHg | |
| Molecular Formula | C11H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 10ºC | |
| Name | ethenol,ethenyl acetate,methyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 100.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.25800 |
| Flash Point | 10ºC |
| Exact Mass | 230.11500 |
| PSA | 72.83000 |
| LogP | 2.11640 |
| InChIKey | GDFYZCPHYBHGRN-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC.C=CO.C=COC(C)=O |
| Acetic acid vinyl ester,methyl methacrylate,vinyl alcohol polymer |
| 2-Propenoic acid,2-methyl-,methyl ester,polymer with ethenol and ethenyl acetate |
| Acetic acid,ethenyl ester,ethenol,2-propenoic acid,2-methyl-,methyl ester polymer |