1-[(6-methoxyquinolin-8-yl)amino]-2-methyl-3-(1-piperidyl)propan-2-ol structure
|
Common Name | 1-[(6-methoxyquinolin-8-yl)amino]-2-methyl-3-(1-piperidyl)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 5463-70-7 | Molecular Weight | 329.43700 | |
| Density | 1.173g/cm3 | Boiling Point | 542.8ºC at 760 mmHg | |
| Molecular Formula | C19H27N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.1ºC | |
| Name | 1-[(6-methoxyquinolin-8-yl)amino]-2-methyl-3-piperidin-1-ylpropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 542.8ºC at 760 mmHg |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.43700 |
| Flash Point | 282.1ºC |
| Exact Mass | 329.21000 |
| PSA | 57.62000 |
| LogP | 2.90310 |
| Index of Refraction | 1.618 |
| InChIKey | VZGPVEMFEPUXIX-UHFFFAOYSA-N |
| SMILES | COc1cc(NCC(C)(O)CN2CCCCC2)c2ncccc2c1 |
|
~%
1-[(6-methoxyqu... CAS#:5463-70-7 |
| Literature: Rohrmann; Shonle Journal of the American Chemical Society, 1944 , vol. 66, p. 1640 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-(6-METHOXY-2-NAPHTHALENYL)-1-HEPTANONE |
| 1-(6-methoxy-[2]naphthyl)-heptan-1-one |
| hexyl 6-methoxy-2-naphthyl ketone |
| 1-(6-methoxy-[8]quinolylamino)-2-methyl-3-piperidino-propan-2-ol |
| (6-Methoxy-2-naphthyl)heptan-1-one |
| 1-(6-methoxy-naphthalen-2-yl)heptan-1-one |
| 1-(6-Methoxy-[8]chinolylamino)-2-methyl-3-piperidino-propan-2-ol |
| 2-Heptanoyl-6-methoxy-naphthalin |
| 6-Methoxy-2-heptanonaphthone |
| 1-(6-Methoxy-[2]naphthyl)-heptan-1-on |