tris[(1-ethynylcyclohexyl)oxy]borane structure
|
Common Name | tris[(1-ethynylcyclohexyl)oxy]borane | ||
|---|---|---|---|---|
| CAS Number | 5463-75-2 | Molecular Weight | 380.32800 | |
| Density | 1.05g/cm3 | Boiling Point | 417ºC at 760 mmHg | |
| Molecular Formula | C24H33BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.7ºC | |
| Name | tris(1-ethynylcyclohexyl) borate |
|---|
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 417ºC at 760 mmHg |
| Molecular Formula | C24H33BO3 |
| Molecular Weight | 380.32800 |
| Flash Point | 147.7ºC |
| Exact Mass | 380.25200 |
| PSA | 27.69000 |
| LogP | 5.02940 |
| Index of Refraction | 1.515 |
| InChIKey | LHERKSXYIXCMIE-UHFFFAOYSA-N |
| SMILES | C#CC1(OB(OC2(C#C)CCCCC2)OC2(C#C)CCCCC2)CCCCC1 |
| HS Code | 2920909090 |
|---|
|
~%
tris[(1-ethynyl... CAS#:5463-75-2 |
| Literature: Steinberg; Hunter Industrial and Engineering Chemistry, 1957 , vol. 49, p. 174,175 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |