Benzenesulfonamide,N-(2-nitrophenyl)-N-(phenylsulfonyl)- structure
|
Common Name | Benzenesulfonamide,N-(2-nitrophenyl)-N-(phenylsulfonyl)- | ||
|---|---|---|---|---|
| CAS Number | 5464-23-3 | Molecular Weight | 418.44400 | |
| Density | 1.501g/cm3 | Boiling Point | 610.2ºC at 760mmHg | |
| Molecular Formula | C18H14N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.8ºC | |
| Name | N-(2-nitrophenyl)-N-phenylsulfonylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.501g/cm3 |
|---|---|
| Boiling Point | 610.2ºC at 760mmHg |
| Molecular Formula | C18H14N2O6S2 |
| Molecular Weight | 418.44400 |
| Flash Point | 322.8ºC |
| Exact Mass | 418.02900 |
| PSA | 134.10000 |
| LogP | 5.86380 |
| Index of Refraction | 1.667 |
| InChIKey | OCMWVYODQVCYPU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1N(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| HS Code | 2935009090 |
|---|
|
~%
Benzenesulfonam... CAS#:5464-23-3 |
| Literature: Amundsen Journal of the American Chemical Society, 1937 , vol. 59, p. 1466 |
|
~10%
Benzenesulfonam... CAS#:5464-23-3 |
| Literature: Yasuhara, Akito; Kameda, Mitsuyoshi; Sakamoto, Takao Chemical and Pharmaceutical Bulletin, 1999 , vol. 47, # 6 p. 809 - 812 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N,N-bis-benzenesulfonyl-2-nitro-aniline |
| N,N-Bis-benzolsulfonyl-2-nitro-anilin |