ethyl 2-[acetyl-(3-ethoxy-3-oxopropyl)amino]-4-methylsulfanylbutanoate structure
|
Common Name | ethyl 2-[acetyl-(3-ethoxy-3-oxopropyl)amino]-4-methylsulfanylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 5464-47-1 | Molecular Weight | 319.41700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[acetyl-(3-ethoxy-3-oxopropyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H25NO5S |
|---|---|
| Molecular Weight | 319.41700 |
| Exact Mass | 319.14500 |
| PSA | 98.21000 |
| LogP | 1.47290 |
| InChIKey | NTDAONOBHYSBRN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCN(C(C)=O)C(CCSC)C(=O)OCC |
|
~%
ethyl 2-[acetyl... CAS#:5464-47-1 |
| Literature: McKinney et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 5183 |
|
~%
ethyl 2-[acetyl... CAS#:5464-47-1 |
| Literature: McKinney et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 5183 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| ethyl N-acetyl-N-(3-ethoxy-3-oxopropyl)methioninate |
| N-acetyl-N-(2-ethoxycarbonyl-ethyl)-methionine ethyl ester |
| N-Acetyl-N-(2-aethoxycarbonyl-aethyl)-methionin-aethylester |