(Z)-3-(3-bromo-2,4,6-trimethyl-phenyl)-3-chloro-2-methyl-prop-2-enoic acid structure
|
Common Name | (Z)-3-(3-bromo-2,4,6-trimethyl-phenyl)-3-chloro-2-methyl-prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 5465-23-6 | Molecular Weight | 317.60600 | |
| Density | 1.436g/cm3 | Boiling Point | 386.3ºC at 760 mmHg | |
| Molecular Formula | C13H14BrClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.4ºC | |
| Name | (Z)-3-(3-bromo-2,4,6-trimethylphenyl)-3-chloro-2-methylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.436g/cm3 |
|---|---|
| Boiling Point | 386.3ºC at 760 mmHg |
| Molecular Formula | C13H14BrClO2 |
| Molecular Weight | 317.60600 |
| Flash Point | 187.4ºC |
| Exact Mass | 315.98700 |
| PSA | 37.30000 |
| LogP | 4.42870 |
| Index of Refraction | 1.582 |
| InChIKey | YEGQXLHJORQHOM-XFXZXTDPSA-N |
| SMILES | CC(C(=O)O)=C(Cl)c1c(C)cc(C)c(Br)c1C |
| HS Code | 2916399090 |
|---|
|
~%
(Z)-3-(3-bromo-... CAS#:5465-23-6 |
| Literature: Adams; Miller Journal of the American Chemical Society, 1940 , vol. 62, p. 53,55 |
|
~%
(Z)-3-(3-bromo-... CAS#:5465-23-6 |
| Literature: Adams; Miller Journal of the American Chemical Society, 1940 , vol. 62, p. 53,55 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-chloro-2-methyl-3-(3-bromo-2.4.6-trimethyl-phenyl)-acrylic acid |
| 3-Chlor-2-methyl-3-(3-brom-2.4.6-trimethyl-phenyl)-acrylsaeure |
| (+-)-3-chloro-2-methyl-3-(3-bromo-2.4.6-trimethyl-phenyl)-acryl |
| (+-)-3-Chlor-2-methyl-3-(3-brom-2.4.6-trimethyl-phenyl)-acryl |