(6-benzoyl-1-cyclohex-3-enyl)-phenyl-methanone structure
|
Common Name | (6-benzoyl-1-cyclohex-3-enyl)-phenyl-methanone | ||
|---|---|---|---|---|
| CAS Number | 5465-44-1 | Molecular Weight | 290.35600 | |
| Density | 1.144g/cm3 | Boiling Point | 444.5ºC at 760 mmHg | |
| Molecular Formula | C20H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.7ºC | |
| Name | (6-benzoylcyclohex-3-en-1-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 444.5ºC at 760 mmHg |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.35600 |
| Flash Point | 165.7ºC |
| Exact Mass | 290.13100 |
| PSA | 34.14000 |
| LogP | 4.33460 |
| Index of Refraction | 1.597 |
| InChIKey | VJAXJFWMMZTLLB-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C1CC=CCC1C(=O)c1ccccc1 |
|
~%
(6-benzoyl-1-cy... CAS#:5465-44-1 |
| Literature: Adams; Gold Journal of the American Chemical Society, 1940 , vol. 62, p. 56,60 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| hms3080a21 |