[2,5-dibromo-3,6-bis(2,4-dimethylphenyl)-4-[2-[(1R,2S,5R)-5-methyl-2-propan-2-yl-cyclohexyl]oxyacetyl]oxy-phenyl] 2-[(1R,2S,5R)-5-methyl-2-propan-2-yl-cyclohexyl]oxyacetate structure
|
Common Name | [2,5-dibromo-3,6-bis(2,4-dimethylphenyl)-4-[2-[(1R,2S,5R)-5-methyl-2-propan-2-yl-cyclohexyl]oxyacetyl]oxy-phenyl] 2-[(1R,2S,5R)-5-methyl-2-propan-2-yl-cyclohexyl]oxyacetate | ||
|---|---|---|---|---|
| CAS Number | 5465-55-4 | Molecular Weight | 868.77300 | |
| Density | 1.3g/cm3 | Boiling Point | 791.7ºC at 760 mmHg | |
| Molecular Formula | C46H60Br2O6 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 432.6ºC | |
| Name | 2,3-Dicyano-1,4-hydroquinone diacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 791.7ºC at 760 mmHg |
| Molecular Formula | C46H60Br2O6 |
| Molecular Weight | 868.77300 |
| Flash Point | 432.6ºC |
| Exact Mass | 866.27600 |
| PSA | 71.06000 |
| LogP | 12.54480 |
| Index of Refraction | 1.585 |
| InChIKey | SIYIQIXVJVQMDI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2c(Br)c(OC(=O)COC3CC(C)CCC3C(C)C)c(-c3ccc(C)cc3C)c(Br)c2OC(=O)COC2CC(C)CCC2C(C)C)c(C)c1 |
|
~%
[2,5-dibromo-3,... CAS#:5465-55-4 |
| Literature: Knauf; Shildneck; Adams Journal of the American Chemical Society, 1934 , vol. 56, p. 2109 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzene,1,4-diacetyloxy-2,3-dicyano |
| 1,4-Diacetoxy-2,3-dicyanobenzene |
| DADCB |
| D0679_SIAL |
| 3,6-Diacetoxyphthalonitrile |
| 3.6-Diacetoxy-phthalsaeure-dinitril |
| 2,3-Dicyanochinol-diacetat |