Echinocandin B structure
|
Common Name | Echinocandin B | ||
|---|---|---|---|---|
| CAS Number | 54651-05-7 | Molecular Weight | 1060.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C52H81N7O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Echinocandin BEchinocandin B (A 30912) is an antifungal antibiotic and is the secondary metabolite produced by Aspergillus nidulans[1]. |
| Name | echinocandin B |
|---|
| Description | Echinocandin B (A 30912) is an antifungal antibiotic and is the secondary metabolite produced by Aspergillus nidulans[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C52H81N7O16 |
|---|---|
| Molecular Weight | 1060.24000 |
| Exact Mass | 1059.57000 |
| PSA | 368.19000 |
| LogP | 0.25150 |
| InChIKey | FAUOJMHVEYMQQG-HVYQDZECSA-N |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)NC1CC(O)C(O)NC(=O)C2C(O)C(C)CN2C(=O)C(C(C)O)NC(=O)C(C(O)C(O)c2ccc(O)cc2)NC(=O)C2CC(O)CN2C(=O)C(C(C)O)NC1=O |