2-(2-methylphenyl)pyrido[2,3-b]pyrazine-3,6-diamine structure
|
Common Name | 2-(2-methylphenyl)pyrido[2,3-b]pyrazine-3,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 5466-19-3 | Molecular Weight | 251.28700 | |
| Density | 1.41g/cm3 | Boiling Point | 457.1ºC at 760 mmHg | |
| Molecular Formula | C14H13N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.2ºC | |
| Name | 2-(2-methylphenyl)pyrido[2,3-b]pyrazine-3,6-diamine |
|---|
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 457.1ºC at 760 mmHg |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.28700 |
| Flash Point | 230.2ºC |
| Exact Mass | 251.11700 |
| PSA | 90.71000 |
| LogP | 3.32700 |
| Index of Refraction | 1.738 |
| InChIKey | SPTCKGCJAKBNDE-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-c1nc2ccc(N)nc2nc1N |
|
~%
2-(2-methylphen... CAS#:5466-19-3 |
| Literature: Osdene; Timmis Journal of the Chemical Society, 1955 , p. 2032,2034 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |