2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid structure
|
Common Name | 2-(2,4-dimethylphenyl)quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 5466-33-1 | Molecular Weight | 277.31700 | |
| Density | 1.22g/cm3 | Boiling Point | 454.8ºC at 760 mmHg | |
| Molecular Formula | C18H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.9ºC | |
| Name | 2-(2,4-dimethylphenyl)quinoline-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 454.8ºC at 760 mmHg |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.31700 |
| Flash Point | 228.9ºC |
| Exact Mass | 277.11000 |
| PSA | 50.19000 |
| LogP | 4.21680 |
| Index of Refraction | 1.655 |
| InChIKey | LQOCMAVPLYTGBG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2cc(C(=O)O)c3ccccc3n2)c(C)c1 |
| HS Code | 2933499090 |
|---|
|
~%
2-(2,4-dimethyl... CAS#:5466-33-1 |
| Literature: Bulletin de la Societe Chimique de France, , p. 123,130 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2',4'-dimethylphenyl)quinoline-4-carboxylic acid |
| 2-(2,4-Dimethylphenyl)-chinolin-4-carbonsaeure |
| 2,6-DIMETHOXYISONICOTINIC ACID |