2,2-diphenylbutanamide structure
|
Common Name | 2,2-diphenylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 5466-38-6 | Molecular Weight | 239.31200 | |
| Density | 1.087g/cm3 | Boiling Point | 411.1ºC at 760 mmHg | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | 2,2-diphenylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 411.1ºC at 760 mmHg |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.31200 |
| Flash Point | 202.4ºC |
| Exact Mass | 239.13100 |
| PSA | 43.09000 |
| LogP | 3.56830 |
| Index of Refraction | 1.574 |
| InChIKey | YEUNWXVEHKUOBQ-UHFFFAOYSA-N |
| SMILES | CCC(C(N)=O)(c1ccccc1)c1ccccc1 |
|
~%
2,2-diphenylbut... CAS#:5466-38-6 |
| Literature: Zaugg; Horrom Journal of the American Chemical Society, 1950 , vol. 72, p. 3004,3005 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2,2-diphenyl-butyric acid amide |
| 2,2-Diphenyl-buttersaeure-amid |
| ethyl diphenylacetamide |