(3-hydroxy-4-methoxy-9-phenyl-5,8,10-trioxabicyclo[4.4.0]dec-2-yl) N-phenylcarbamate structure
|
Common Name | (3-hydroxy-4-methoxy-9-phenyl-5,8,10-trioxabicyclo[4.4.0]dec-2-yl) N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 5466-39-7 | Molecular Weight | 401.41000 | |
| Density | 0.963g/cm3 | Boiling Point | 375.5ºC at 760 mmHg | |
| Molecular Formula | C21H23NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.7ºC | |
| Name | (2S,4aS,8aR)-7-hydroxy-6-methoxy-2-phenylhexahydropyrano[3,2-d][1,3]dioxin-8-yl phenylcarbamate |
|---|
| Density | 0.963g/cm3 |
|---|---|
| Boiling Point | 375.5ºC at 760 mmHg |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.41000 |
| Flash Point | 110.7ºC |
| Exact Mass | 401.14700 |
| PSA | 95.48000 |
| LogP | 2.52310 |
| Index of Refraction | 1.513 |
| InChIKey | YNGYQKUYPGMCIL-UHFFFAOYSA-N |
| SMILES | COC1OC2COC(c3ccccc3)OC2C(OC(=O)Nc2ccccc2)C1O |
|
~%
(3-hydroxy-4-me... CAS#:5466-39-7 |
| Literature: Baker et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 6577,6581 |
|
~%
(3-hydroxy-4-me... CAS#:5466-39-7 |
| Literature: Baker et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 6577,6581 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |