4-bromo-N-[(E)-(3-ethoxy-5-nitro-4-oxo-1-cyclohexa-2,5-dienylidene)methyl]benzohydrazide structure
|
Common Name | 4-bromo-N-[(E)-(3-ethoxy-5-nitro-4-oxo-1-cyclohexa-2,5-dienylidene)methyl]benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 5466-67-1 | Molecular Weight | 211.22300 | |
| Density | 1.28g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H9N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(cyanomethyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonitrile |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.22300 |
| Exact Mass | 211.08600 |
| PSA | 77.77000 |
| LogP | 1.28386 |
| Index of Refraction | 1.671 |
| InChIKey | MCDUPLXIZMMXMM-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n2nc(CC#N)c(C#N)c2n1 |
|
~%
4-bromo-N-[(E)-... CAS#:5466-67-1 |
| Literature: Taylor; Hartke Journal of the American Chemical Society, 1959 , vol. 81, p. 2452,2455 |
|
~%
4-bromo-N-[(E)-... CAS#:5466-67-1 |
| Literature: Taylor; Hartke Journal of the American Chemical Society, 1959 , vol. 81, p. 2452,2455 |
|
~%
Detail
|
| Literature: Taylor; Hartke Journal of the American Chemical Society, 1959 , vol. 81, p. 2452,2455 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |