5,8,11-Trioxa-2,3,13,14-tetraazapentadecanedioicacid, 4,12-dioxo-, diethyl ester (9CI) structure
|
Common Name | 5,8,11-Trioxa-2,3,13,14-tetraazapentadecanedioicacid, 4,12-dioxo-, diethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 54661-99-3 | Molecular Weight | 366.32400 | |
| Density | 1.298g/cm3 | Boiling Point | 503.7ºC at 760mmHg | |
| Molecular Formula | C12H22N4O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.4ºC | |
| Name | 2-[2-[(ethoxycarbonylamino)carbamoyloxy]ethoxy]ethyl N-(ethoxycarbonylamino)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 503.7ºC at 760mmHg |
| Molecular Formula | C12H22N4O9 |
| Molecular Weight | 366.32400 |
| Flash Point | 258.4ºC |
| Exact Mass | 366.13900 |
| PSA | 162.55000 |
| LogP | 1.34120 |
| Index of Refraction | 1.484 |
| InChIKey | NYUIZQQQAYUWBO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NNC(=O)OCCOCCOC(=O)NNC(=O)OCC |
|
~%
5,8,11-Trioxa-2... CAS#:54661-99-3 |
| Literature: Uniroyal, Inc. Patent: US3946064 A1, 1976 ; |
|
~%
5,8,11-Trioxa-2... CAS#:54661-99-3 |
| Literature: Rabjohn Journal of the American Chemical Society, 1948 , vol. 70, p. 1183 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Diaethylenglykol-bis-aethylhydrazodicarboxylat |
| diethyl 4,12-dioxo-5,8,11-trioxa-2,3,13,14-tetraazapentadecane-1,15-dioate |
| 4,12-Dioxo-5,8,11-trioxa-2,3,13,14-tetraaza-pentadecandisaeure-diaethylester |