methyl 3-[4-(2-bromoacetyl)phenyl]propanoate
Modify Date: 2025-09-18 12:44:32
![methyl 3-[4-(2-bromoacetyl)phenyl]propanoate Structure](https://image.chemsrc.com/caspic/282/5467-32-3.png)
methyl 3-[4-(2-bromoacetyl)phenyl]propanoate structure
|
Common Name | methyl 3-[4-(2-bromoacetyl)phenyl]propanoate | ||
|---|---|---|---|---|
| CAS Number | 5467-32-3 | Molecular Weight | 285.13400 | |
| Density | 1.401g/cm3 | Boiling Point | 361.3ºC at 760 mmHg | |
| Molecular Formula | C12H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.3ºC | |
| Name | methyl 3-[4-(2-bromoacetyl)phenyl]propanoate |
|---|
| Density | 1.401g/cm3 |
|---|---|
| Boiling Point | 361.3ºC at 760 mmHg |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.13400 |
| Flash Point | 172.3ºC |
| Exact Mass | 284.00500 |
| PSA | 43.37000 |
| LogP | 2.36980 |
| Index of Refraction | 1.547 |
| InChIKey | GANIHQPUJCVWMA-UHFFFAOYSA-N |
| SMILES | COC(=O)CCc1ccc(C(=O)CBr)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
methyl 3-[4-(2-... CAS#:5467-32-3 |
| Literature: Skinner et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 4639,4641 |
|
~%
methyl 3-[4-(2-... CAS#:5467-32-3 |
| Literature: GLAXO GROUP LIMITED; WANG, Yonghui; CAI, Wei; LIU, Qian; XIANG, Jia-Ning Patent: WO2012/27965 A1, 2012 ; WO 2012/027965 A1 |
![imino-[2-[4-(2-methoxycarbonylethyl)phenyl]-2-oxo-ethyl]imino-azanium structure](https://image.chemsrc.com/caspic/252/5472-63-9.png)
CAS#:5472-63-9![methyl 3-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]phenyl]propanoate structure](https://image.chemsrc.com/caspic/204/5472-64-0.png)
CAS#:5472-64-0| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |