Ethanamine,N,N-dimethyl-2-[1-phenyl-1-(2-quinolinyl)ethoxy]-
Modify Date: 2025-09-15 19:09:53
![Ethanamine,N,N-dimethyl-2-[1-phenyl-1-(2-quinolinyl)ethoxy]- Structure](https://image.chemsrc.com/caspic/106/5467-90-3.png)
Ethanamine,N,N-dimethyl-2-[1-phenyl-1-(2-quinolinyl)ethoxy]- structure
|
Common Name | Ethanamine,N,N-dimethyl-2-[1-phenyl-1-(2-quinolinyl)ethoxy]- | ||
|---|---|---|---|---|
| CAS Number | 5467-90-3 | Molecular Weight | 320.42800 | |
| Density | 1.092g/cm3 | Boiling Point | 435.9ºC at 760mmHg | |
| Molecular Formula | C21H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.4ºC | |
| Name | N,N-dimethyl-2-(1-phenyl-1-quinolin-2-ylethoxy)ethanamine |
|---|
| Density | 1.092g/cm3 |
|---|---|
| Boiling Point | 435.9ºC at 760mmHg |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.42800 |
| Flash Point | 217.4ºC |
| Exact Mass | 320.18900 |
| PSA | 25.36000 |
| LogP | 4.07650 |
| Index of Refraction | 1.595 |
| InChIKey | YDJVFOAHQRFWRZ-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC(C)(c1ccccc1)c1ccc2ccccc2n1 |
| HS Code | 2933499090 |
|---|
|
~%
Ethanamine,N,N-... CAS#:5467-90-3 |
| Literature: Rose et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 341,343 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |