ethyl 3-ethyl-4,5-dioxo-1,2-diphenyl-pyrrolidine-3-carboxylate structure
|
Common Name | ethyl 3-ethyl-4,5-dioxo-1,2-diphenyl-pyrrolidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5468-11-1 | Molecular Weight | 351.39600 | |
| Density | 1.206g/cm3 | Boiling Point | 476.7ºC at 760 mmHg | |
| Molecular Formula | C21H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.1ºC | |
| Name | ethyl 3-ethyl-4,5-dioxo-1,2-diphenylpyrrolidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 476.7ºC at 760 mmHg |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.39600 |
| Flash Point | 242.1ºC |
| Exact Mass | 351.14700 |
| PSA | 63.68000 |
| LogP | 3.36810 |
| Index of Refraction | 1.573 |
| InChIKey | WFIJIJHHQAYKKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC)C(=O)C(=O)N(c2ccccc2)C1c1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~%
ethyl 3-ethyl-4... CAS#:5468-11-1 |
| Literature: Vaughan; Covey Journal of the American Chemical Society, 1958 , vol. 80, p. 2197,2200 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-ethyl-4,5-dioxo-1,2-diphenyl-pyrrolidine-3-carboxylic acid ethyl ester |
| ETHYL 3-ETHYL-4,5-DIOXO-1,2-DIPHENYL-PYRROLIDINE-3-CARBOXYLATE |
| 3-Aethyl-4,5-dioxo-1,2-diphenyl-pyrrolidin-3-carbonsaeure-aethylester |