2H-Pyrrol-2-one,1,5-dihydro-4-methyl-1,5-diphenyl-3-(phenylamino)- structure
|
Common Name | 2H-Pyrrol-2-one,1,5-dihydro-4-methyl-1,5-diphenyl-3-(phenylamino)- | ||
|---|---|---|---|---|
| CAS Number | 5468-13-3 | Molecular Weight | 340.41800 | |
| Density | 1.22g/cm3 | Boiling Point | 509ºC at 760mmHg | |
| Molecular Formula | C23H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.7ºC | |
| Name | 4-anilino-3-methyl-1,2-diphenyl-2H-pyrrol-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 509ºC at 760mmHg |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.41800 |
| Flash Point | 261.7ºC |
| Exact Mass | 340.15800 |
| PSA | 32.34000 |
| LogP | 5.29860 |
| Index of Refraction | 1.673 |
| InChIKey | UPPBQHNCWJLYHN-UHFFFAOYSA-N |
| SMILES | CC1=C(Nc2ccccc2)C(=O)N(c2ccccc2)C1c1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~%
2H-Pyrrol-2-one... CAS#:5468-13-3 |
| Literature: Gein, V. L.; Popov, A. V.; Andreichikov, Yu. S. J. Gen. Chem. USSR (Engl. Transl.), 1992 , vol. 62, # 12.2 p. 2774 - 2779,2291 - 2295 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,5-diphenyl-3-phenylamino-4-methyl-2,5-dihydropyrrol-2-one |
| 3-Anilino-4-methyl-1,5-diphenyl-5H-pyrrolon-(2) |
| 4-methyl-1,5-diphenyl-3-(phenylamino)-1,5-dihydro-2h-pyrrol-2-one |
| 3-anilino-4-methyl-1,5-diphenyl-1,5-dihydro-pyrrol-2-one |