Butanediamide,2-(4-methylphenyl)-3-phenyl- structure
|
Common Name | Butanediamide,2-(4-methylphenyl)-3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5468-18-8 | Molecular Weight | 282.33700 | |
| Density | 1.199g/cm3 | Boiling Point | 537.9ºC at 760mmHg | |
| Molecular Formula | C17H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.1ºC | |
| Name | 2-(4-methylphenyl)-3-phenylbutanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.199g/cm3 |
|---|---|
| Boiling Point | 537.9ºC at 760mmHg |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.33700 |
| Flash Point | 279.1ºC |
| Exact Mass | 282.13700 |
| PSA | 86.18000 |
| LogP | 3.23360 |
| Index of Refraction | 1.609 |
| InChIKey | BCHXAEAMADRKNU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C(N)=O)C(C(N)=O)c2ccccc2)cc1 |
|
~%
Butanediamide,2... CAS#:5468-18-8 |
| Literature: McRae; Conn; Platt Canadian Journal of Research, Section B: Chemical Sciences, 1937 , vol. 15, p. 46,49 |
| 2-phenyl-3-p-tolyl-succinic acid diamide |
| 2-Phenyl-3-p-tolyl-bernsteinsaeure-diamid |